| Name | Amodiaquine HCL |
| Synonyms | AMODIAQUINE HCL Amodiaquine HCL AMODIAQUIN HYDROCHLORIDE AmodiaquineHydrochloride AMODIAQUINE 2HCL DIHYDRATE AMODIAQUIN DIHYDROCHLORIDE AMODIAQUINE DIHYDROCHLORIDE Amodiaquine hydrochloride USP24 amodiaquin dihydrochloride dihydrate Amodiaquin dihydrochloride dihydrate AMODIAQUINE DIHYDROCHLORIDE 2-HYDRATE 4-[(7-chloroquinolin-4-yl)amino]-2-[(diethylamino)methyl]phenol 5-[(7-chloroquinolin-4-yl)amino]-2-[(diethylamino)methyl]phenol dihydrochloride 4-[(7-chloroquinolin-4-yl)amino]-2-[(diethylamino)methyl]phenol dihydrochloride 4-[(7-chloroquinolin-4-yl)amino]-2-[(diethylamino)methyl]phenol dihydrochloride dihydrate |
| CAS | 6398-98-7 |
| EINECS | 642-210-0 |
| InChI | InChI=1/C20H22ClN3O.2ClH/c1-3-24(4-2)13-14-5-7-16(12-20(14)25)23-18-9-10-22-19-11-15(21)6-8-17(18)19;;/h5-12,25H,3-4,13H2,1-2H3,(H,22,23);2*1H |
| Molecular Formula | C20H24Cl3N3O |
| Molar Mass | 428.78 |
| Boling Point | 535.4°C at 760 mmHg |
| Flash Point | 277.6°C |
| Solubility | Soluble in DMSO or methanol |
| Vapor Presure | 4.47E-12mmHg at 25°C |
| Appearance | neat |
| Color | White to Yellow to Orange |
| Maximum wavelength(λmax) | ['342nm(MeOH)(lit.)'] |
| Merck | 14,572 |
| Storage Condition | Inert atmosphere,Room Temperature |
| Use | Used as an antimalarial drug |
| In vivo study | In vivo experiments in dogs, small doses of amodiaquine significantly enhanced the effect of histamine on gastric secretion. In mice with P. acnes-primed and LPS-induced hepatitis, treatment with amodiaquine effectively prevented severe liver injury and high lethality, enhancing the elevation of histamine without increasing tele-methylhistamine (t-MeHA). |
| WGK Germany | 3 |
| RTECS | GO7300100 |
| HS Code | 2933492250 |
| 1mg | 5mg | 10mg | |
|---|---|---|---|
| 1 mM | 2.151 ml | 10.757 ml | 21.514 ml |
| 5 mM | 0.43 ml | 2.151 ml | 4.303 ml |
| 10 mM | 0.215 ml | 1.076 ml | 2.151 ml |
| 5 mM | 0.043 ml | 0.215 ml | 0.43 ml |